C13H15Cl2F3N2O — CID 171177983
(3S)-3-(2,3-dichloro-6-fluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol (PubChem CID 171177983) has the molecular formula C13H15Cl2F3N2O and a molecular weight of 343.18 g/mol. Its IUPAC name is (3S)-3-(2,3-dichloro-6-fluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol.
| Compound Name | (3S)-3-(2,3-dichloro-6-fluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 171177983 |
| Molecular Formula | C13H15Cl2F3N2O |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (3S)-3-(2,3-dichloro-6-fluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol |
| SMILES | OCC(F)(F)[C@H](c1c(F)ccc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15Cl2F3N2O/c14-8-1-2-9(16)10(11(8)15)12(13(17,18)7-21)20-5-3-19-4-6-20/h1-2,12,19,21H,3-7H2/t12-/m0/s1 |
| InChIKey | KXRBEDSIHFNGCH-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|