C15H21ClF2N2O — CID 171177098
(3R)-3-(2-chloro-3,6-difluorophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol (PubChem CID 171177098) has the molecular formula C15H21ClF2N2O and a molecular weight of 318.80 g/mol. Its IUPAC name is (3R)-3-(2-chloro-3,6-difluorophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol.
| Compound Name | (3R)-3-(2-chloro-3,6-difluorophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 171177098 |
| Molecular Formula | C15H21ClF2N2O |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3R)-3-(2-chloro-3,6-difluorophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol |
| SMILES | CC(C)(CO)[C@H](c1c(F)ccc(F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C15H21ClF2N2O/c1-15(2,9-21)14(20-7-5-19-6-8-20)12-10(17)3-4-11(18)13(12)16/h3-4,14,19,21H,5-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | OADDRLDLNBIDBV-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|