C13H16Cl2F4N2O — CID 171176983
(3S)-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol;hydrochloride (PubChem CID 171176983) has the molecular formula C13H16Cl2F4N2O and a molecular weight of 363.18 g/mol. Its IUPAC name is (3S)-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (3S)-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171176983 |
| Molecular Formula | C13H16Cl2F4N2O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (3S)-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol;hydrochloride |
| SMILES | Cl.OCC(F)(F)[C@H](c1c(F)ccc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF4N2O.ClH/c14-8-1-2-9(15)10(11(8)16)12(13(17,18)7-21)20-5-3-19-4-6-20;/h1-2,12,19,21H,3-7H2;1H/t12-;/m0./s1 |
| InChIKey | RJQZKDYPURIPEE-YDALLXLXSA-N |
| XLogP | 2.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|