C13H17Cl5F3N3 — CID 171303657
1-[(1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butyl]piperazine;dihydrochloride (PubChem CID 171303657) has the molecular formula C13H17Cl5F3N3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303657 |
| Molecular Formula | C13H17Cl5F3N3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CC[C@H](c1c(Cl)cnc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15Cl3F3N3.2ClH/c14-8-7-21-12(16)11(15)10(8)9(1-2-13(17,18)19)22-5-3-20-4-6-22;;/h7,9,20H,1-6H2;2*1H/t9-;;/m1../s1 |
| InChIKey | GABSZGATDCZTPA-KLQYNRQASA-N |
| XLogP | 5.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|