C9H9Cl4F3N2 — CID 171204932
(1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butan-1-amine;hydrochloride (PubChem CID 171204932) has the molecular formula C9H9Cl4F3N2 and a molecular weight of 343.99 g/mol. Its IUPAC name is (1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204932 |
| Molecular Formula | C9H9Cl4F3N2 |
| Molecular Weight | 343.99 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | (1R)-4,4,4-trifluoro-1-(2,3,5-trichloro-4-pyridinyl)butan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](CCC(F)(F)F)c1c(Cl)cnc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3F3N2.ClH/c10-4-3-17-8(12)7(11)6(4)5(16)1-2-9(13,14)15;/h3,5H,1-2,16H2;1H/t5-;/m1./s1 |
| InChIKey | XZZYFDRYFAIPIR-NUBCRITNSA-N |
| XLogP | 4.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|