About ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride
ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride (PubChem CID 171204952) has the molecular formula C10H12Cl4N2O2
and a molecular weight of 334.03 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride |
| PubChem CID | 171204952 |
| Molecular Formula | C10H12Cl4N2O2 |
| Molecular Weight | 334.03 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H](N)c1c(Cl)cnc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C10H11Cl3N2O2.ClH/c1-2-17-7(16)3-6(14)8-5(11)4-15-10(13)9(8)12;/h4,6H,2-3,14H2,1H3;1H/t6-;/m1./s1 |
| InChIKey | JOMWCPVJTGTMLW-FYZOBXCZSA-N |
| XLogP | 3.42 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.03 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride?
The IUPAC name of ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride (CID 171204952) is ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride.
What is the SMILES notation for ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride?
The canonical SMILES for ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride is CCOC(=O)C[C@@H](N)c1c(Cl)cnc(Cl)c1Cl.Cl.
What is the InChIKey of ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride?
The InChIKey is JOMWCPVJTGTMLW-FYZOBXCZSA-N. The full InChI is InChI=1S/C10H11Cl3N2O2.ClH/c1-2-17-7(16)3-6(14)8-5(11)4-15-10(13)9(8)12;/h4,6H,2-3,14H2,1H3;1H/t6-;/m1./s1.
What are the key properties of ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride?
ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride has a molecular weight of 334.03 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-amino-3-(2,3,5-trichloro-4-pyridinyl)propanoate;hydrochloride is sourced from PubChem (CID 171204952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).