C14H17Cl4NO2 — CID 105349620
ethyl 5-amino-3-methyl-5-(2,3,4,6-tetrachlorophenyl)pentanoate (PubChem CID 105349620) has the molecular formula C14H17Cl4NO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is ethyl 5-amino-3-methyl-5-(2,3,4,6-tetrachlorophenyl)pentanoate.
| Compound Name | ethyl 5-amino-3-methyl-5-(2,3,4,6-tetrachlorophenyl)pentanoate |
|---|---|
| PubChem CID | 105349620 |
| Molecular Formula | C14H17Cl4NO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | ethyl 5-amino-3-methyl-5-(2,3,4,6-tetrachlorophenyl)pentanoate |
| SMILES | CCOC(=O)CC(C)CC(N)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl4NO2/c1-3-21-11(20)5-7(2)4-10(19)12-8(15)6-9(16)13(17)14(12)18/h6-7,10H,3-5,19H2,1-2H3 |
| InChIKey | PWWJATGPGBCZTJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|