C12H17Br2NO2S — CID 80535552
ethyl 5-amino-5-(4,5-dibromothiophen-2-yl)-3-methylpentanoate (PubChem CID 80535552) has the molecular formula C12H17Br2NO2S and a molecular weight of 399.15 g/mol. Its IUPAC name is ethyl 5-amino-5-(4,5-dibromothiophen-2-yl)-3-methylpentanoate.
| Compound Name | ethyl 5-amino-5-(4,5-dibromothiophen-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 80535552 |
| Molecular Formula | C12H17Br2NO2S |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | ethyl 5-amino-5-(4,5-dibromothiophen-2-yl)-3-methylpentanoate |
| SMILES | CCOC(=O)CC(C)CC(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2NO2S/c1-3-17-11(16)5-7(2)4-9(15)10-6-8(13)12(14)18-10/h6-7,9H,3-5,15H2,1-2H3 |
| InChIKey | YNKCOAPUGDVQCK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |