C14H19Br2NO2S — CID 102844868
ethyl 3-(4,5-dibromothiophen-2-yl)-3-piperidin-1-ylpropanoate (PubChem CID 102844868) has the molecular formula C14H19Br2NO2S and a molecular weight of 425.19 g/mol. Its IUPAC name is ethyl 3-(4,5-dibromothiophen-2-yl)-3-piperidin-1-ylpropanoate.
| Compound Name | ethyl 3-(4,5-dibromothiophen-2-yl)-3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 102844868 |
| Molecular Formula | C14H19Br2NO2S |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | ethyl 3-(4,5-dibromothiophen-2-yl)-3-piperidin-1-ylpropanoate |
| SMILES | CCOC(=O)CC(c1cc(Br)c(Br)s1)N1CCCCC1 |
| InChI | InChI=1S/C14H19Br2NO2S/c1-2-19-13(18)9-11(17-6-4-3-5-7-17)12-8-10(15)14(16)20-12/h8,11H,2-7,9H2,1H3 |
| InChIKey | KCXPKKRBAUUNLB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |