C11H16Br2N2S — CID 102838136
2-(4,5-dibromothiophen-2-yl)-2-piperidin-1-ylethanamine (PubChem CID 102838136) has the molecular formula C11H16Br2N2S and a molecular weight of 368.14 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-2-piperidin-1-ylethanamine.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 102838136 |
| Molecular Formula | C11H16Br2N2S |
| Molecular Weight | 368.14 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-2-piperidin-1-ylethanamine |
| SMILES | NCC(c1cc(Br)c(Br)s1)N1CCCCC1 |
| InChI | InChI=1S/C11H16Br2N2S/c12-8-6-10(16-11(8)13)9(7-14)15-4-2-1-3-5-15/h6,9H,1-5,7,14H2 |
| InChIKey | WUZAADFLYMKRCC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.14 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |