C11H17BrClN3O2S2 — CID 102839158
2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine (PubChem CID 102839158) has the molecular formula C11H17BrClN3O2S2 and a molecular weight of 402.77 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102839158 |
| Molecular Formula | C11H17BrClN3O2S2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine |
| SMILES | CS(=O)(=O)N1CCN(C(CN)c2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C11H17BrClN3O2S2/c1-20(17,18)16-4-2-15(3-5-16)9(7-14)10-6-8(12)11(13)19-10/h6,9H,2-5,7,14H2,1H3 |
| InChIKey | KPIFQKWKJXRESE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |