C11H16BrClN2S — CID 102838519
2-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methylpyrrolidin-1-yl)ethanamine (PubChem CID 102838519) has the molecular formula C11H16BrClN2S and a molecular weight of 323.69 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methylpyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methylpyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102838519 |
| Molecular Formula | C11H16BrClN2S |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methylpyrrolidin-1-yl)ethanamine |
| SMILES | CC1CCCN1C(CN)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C11H16BrClN2S/c1-7-3-2-4-15(7)9(6-14)10-5-8(12)11(13)16-10/h5,7,9H,2-4,6,14H2,1H3 |
| InChIKey | LUIJMVPNCQCEJJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |