C12H19BrN2S — CID 43123628
2-(4-bromothiophen-2-yl)-2-(2-methylpiperidin-1-yl)ethanamine (PubChem CID 43123628) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(2-methylpiperidin-1-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(2-methylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 43123628 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(2-methylpiperidin-1-yl)ethanamine |
| SMILES | CC1CCCCN1C(CN)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H19BrN2S/c1-9-4-2-3-5-15(9)11(7-14)12-6-10(13)8-16-12/h6,8-9,11H,2-5,7,14H2,1H3 |
| InChIKey | RFARUXKTWVAFNH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |