C15H23BrN2S — CID 102839817
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(4-bromo-5-methylthiophen-2-yl)ethanamine (PubChem CID 102839817) has the molecular formula C15H23BrN2S and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(4-bromo-5-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(4-bromo-5-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 102839817 |
| Molecular Formula | C15H23BrN2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(4-bromo-5-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1sc(C(CN)N2CCC3CCCCC32)cc1Br |
| InChI | InChI=1S/C15H23BrN2S/c1-10-12(16)8-15(19-10)14(9-17)18-7-6-11-4-2-3-5-13(11)18/h8,11,13-14H,2-7,9,17H2,1H3 |
| InChIKey | HROWODJNEUTWBL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |