C13H18Br2N2OS — CID 102838907
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(4,5-dibromothiophen-2-yl)ethanamine (PubChem CID 102838907) has the molecular formula C13H18Br2N2OS and a molecular weight of 410.18 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(4,5-dibromothiophen-2-yl)ethanamine.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(4,5-dibromothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 102838907 |
| Molecular Formula | C13H18Br2N2OS |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(4,5-dibromothiophen-2-yl)ethanamine |
| SMILES | NCC(c1cc(Br)c(Br)s1)N1CCOC2CCCC21 |
| InChI | InChI=1S/C13H18Br2N2OS/c14-8-6-12(19-13(8)15)10(7-16)17-4-5-18-11-3-1-2-9(11)17/h6,9-11H,1-5,7,16H2 |
| InChIKey | CPIAGGZJDIZPFF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |