C15H23ClN2S — CID 102725518
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5-chlorothiophen-2-yl)ethanamine (PubChem CID 102725518) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5-chlorothiophen-2-yl)ethanamine.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5-chlorothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 102725518 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5-chlorothiophen-2-yl)ethanamine |
| SMILES | NCC(c1ccc(Cl)s1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H23ClN2S/c16-15-8-7-14(19-15)13(10-17)18-9-3-5-11-4-1-2-6-12(11)18/h7-8,11-13H,1-6,9-10,17H2/t11-,12-,13?/m1/s1 |
| InChIKey | VTKJRXBFMJNDPG-ZNRZSNADSA-N |
| XLogP | 4.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |