C13H21ClN2OS — CID 106586033
2-(5-chlorothiophen-2-yl)-2-[3-(methoxymethyl)piperidin-1-yl]ethanamine (PubChem CID 106586033) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-2-[3-(methoxymethyl)piperidin-1-yl]ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-2-[3-(methoxymethyl)piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 106586033 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-2-[3-(methoxymethyl)piperidin-1-yl]ethanamine |
| SMILES | COCC1CCCN(C(CN)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H21ClN2OS/c1-17-9-10-3-2-6-16(8-10)11(7-15)12-4-5-13(14)18-12/h4-5,10-11H,2-3,6-9,15H2,1H3 |
| InChIKey | LZPHFWIYWXCZJN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |