C11H17BrClN3S — CID 102838072
2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 102838072) has the molecular formula C11H17BrClN3S and a molecular weight of 338.70 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102838072 |
| Molecular Formula | C11H17BrClN3S |
| Molecular Weight | 338.70 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CN1CCN(C(CN)c2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C11H17BrClN3S/c1-15-2-4-16(5-3-15)9(7-14)10-6-8(12)11(13)17-10/h6,9H,2-5,7,14H2,1H3 |
| InChIKey | RNYZIGHLNHTZJR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |