C11H13Br2NO3S — CID 102844841
3-(4,5-dibromothiophen-2-yl)-3-morpholin-4-ylpropanoic acid (PubChem CID 102844841) has the molecular formula C11H13Br2NO3S and a molecular weight of 399.10 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-3-morpholin-4-ylpropanoic acid.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-3-morpholin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 102844841 |
| Molecular Formula | C11H13Br2NO3S |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-3-morpholin-4-ylpropanoic acid |
| SMILES | O=C(O)CC(c1cc(Br)c(Br)s1)N1CCOCC1 |
| InChI | InChI=1S/C11H13Br2NO3S/c12-7-5-9(18-11(7)13)8(6-10(15)16)14-1-3-17-4-2-14/h5,8H,1-4,6H2,(H,15,16) |
| InChIKey | MUXANJJJHOVNLY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |