C13H15Cl2NO3 — CID 64526353
3-(3,5-dichlorophenyl)-3-morpholin-4-ylpropanoic acid (PubChem CID 64526353) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-morpholin-4-ylpropanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-morpholin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 64526353 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-morpholin-4-ylpropanoic acid |
| SMILES | O=C(O)CC(c1cc(Cl)cc(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H15Cl2NO3/c14-10-5-9(6-11(15)7-10)12(8-13(17)18)16-1-3-19-4-2-16/h5-7,12H,1-4,8H2,(H,17,18) |
| InChIKey | QWDFWLVAVXTARP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |