C13H15ClFNO3 — CID 64528321
3-(4-chloro-3-fluorophenyl)-3-morpholin-4-ylpropanoic acid (PubChem CID 64528321) has the molecular formula C13H15ClFNO3 and a molecular weight of 287.72 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-3-morpholin-4-ylpropanoic acid.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-3-morpholin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 64528321 |
| Molecular Formula | C13H15ClFNO3 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-3-morpholin-4-ylpropanoic acid |
| SMILES | O=C(O)CC(c1ccc(Cl)c(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H15ClFNO3/c14-10-2-1-9(7-11(10)15)12(8-13(17)18)16-3-5-19-6-4-16/h1-2,7,12H,3-6,8H2,(H,17,18) |
| InChIKey | JJKWCSNRQZRVLQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |