3-(3,5-dichlorophenyl)pentanedioic acid

C11H10Cl2O4 — CID 10678120

IUPAC3-(3,5-dichlorophenyl)pentanedioic acid
SMILESO=C(O)CC(CC(=O)O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C11H10Cl2O4/c12-8-1-6(2-9(13)5-8)7(3-10(14)15)4-11(16)17/h1-2,5,7H,3-4H2,(H,14,15)(H,16,17)
InChIKeyBEDBNTBAQDZKBG-UHFFFAOYSA-N
MW277.10 g/mol
LogP3.03
Rot. Bonds5

About 3-(3,5-dichlorophenyl)pentanedioic acid

3-(3,5-dichlorophenyl)pentanedioic acid (PubChem CID 10678120) has the molecular formula C11H10Cl2O4 and a molecular weight of 277.10 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)pentanedioic acid.

Molecular Properties

Compound Name3-(3,5-dichlorophenyl)pentanedioic acid
PubChem CID10678120
Molecular FormulaC11H10Cl2O4
Molecular Weight277.10 g/mol
Exact Mass276.00
IUPAC Name3-(3,5-dichlorophenyl)pentanedioic acid
SMILESO=C(O)CC(CC(=O)O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C11H10Cl2O4/c12-8-1-6(2-9(13)5-8)7(3-10(14)15)4-11(16)17/h1-2,5,7H,3-4H2,(H,14,15)(H,16,17)
InChIKeyBEDBNTBAQDZKBG-UHFFFAOYSA-N
XLogP3.03
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.10
LogP ≤ 53.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(3,5-dichlorophenyl)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dichlorophenyl)pentanedioic acid?
The IUPAC name of 3-(3,5-dichlorophenyl)pentanedioic acid (CID 10678120) is 3-(3,5-dichlorophenyl)pentanedioic acid.
What is the SMILES notation for 3-(3,5-dichlorophenyl)pentanedioic acid?
The canonical SMILES for 3-(3,5-dichlorophenyl)pentanedioic acid is O=C(O)CC(CC(=O)O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-(3,5-dichlorophenyl)pentanedioic acid?
The InChIKey is BEDBNTBAQDZKBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O4/c12-8-1-6(2-9(13)5-8)7(3-10(14)15)4-11(16)17/h1-2,5,7H,3-4H2,(H,14,15)(H,16,17).
What are the key properties of 3-(3,5-dichlorophenyl)pentanedioic acid?
3-(3,5-dichlorophenyl)pentanedioic acid has a molecular weight of 277.10 g/mol, XLogP of 3.03, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenyl)pentanedioic acid is sourced from PubChem (CID 10678120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).