C10H10Cl3FN2O2 — CID 171241328
ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trichloro-4-pyridinyl)propanoate (PubChem CID 171241328) has the molecular formula C10H10Cl3FN2O2 and a molecular weight of 315.56 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trichloro-4-pyridinyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trichloro-4-pyridinyl)propanoate |
|---|---|
| PubChem CID | 171241328 |
| Molecular Formula | C10H10Cl3FN2O2 |
| Molecular Weight | 315.56 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trichloro-4-pyridinyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1c(Cl)cnc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl3FN2O2/c1-2-18-10(17)7(14)8(15)5-4(11)3-16-9(13)6(5)12/h3,7-8H,2,15H2,1H3/t7?,8-/m1/s1 |
| InChIKey | HKTRPTNSMREHQD-BRFYHDHCSA-N |
| XLogP | 2.94 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|