C10H12BrFN2O2 — CID 171240736
ethyl (3R)-3-amino-3-(5-bromo-2-pyridinyl)-2-fluoropropanoate (PubChem CID 171240736) has the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(5-bromo-2-pyridinyl)-2-fluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(5-bromo-2-pyridinyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171240736 |
| Molecular Formula | C10H12BrFN2O2 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | ethyl (3R)-3-amino-3-(5-bromo-2-pyridinyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H12BrFN2O2/c1-2-16-10(15)8(12)9(13)7-4-3-6(11)5-14-7/h3-5,8-9H,2,13H2,1H3/t8?,9-/m1/s1 |
| InChIKey | SPNQTIGQEBYMRB-YGPZHTELSA-N |
| XLogP | 1.75 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |