C10H13BrClFN2O2 — CID 171247483
ethyl (3S)-3-amino-3-(6-bromo-3-pyridinyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171247483) has the molecular formula C10H13BrClFN2O2 and a molecular weight of 327.58 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(6-bromo-3-pyridinyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(6-bromo-3-pyridinyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171247483 |
| Molecular Formula | C10H13BrClFN2O2 |
| Molecular Weight | 327.58 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | ethyl (3S)-3-amino-3-(6-bromo-3-pyridinyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(Br)nc1.Cl |
| InChI | InChI=1S/C10H12BrFN2O2.ClH/c1-2-16-10(15)8(12)9(13)6-3-4-7(11)14-5-6;/h3-5,8-9H,2,13H2,1H3;1H/t8?,9-;/m0./s1 |
| InChIKey | LHZLPZDABRVACN-MTFPJWTKSA-N |
| XLogP | 2.17 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|