C14H15BrF3NO2 — CID 134261935
ethyl 2-(5-bromo-2-pyridinyl)-3-[2-(trifluoromethyl)cyclopropyl]propanoate (PubChem CID 134261935) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is ethyl 2-(5-bromo-2-pyridinyl)-3-[2-(trifluoromethyl)cyclopropyl]propanoate.
| Compound Name | ethyl 2-(5-bromo-2-pyridinyl)-3-[2-(trifluoromethyl)cyclopropyl]propanoate |
|---|---|
| PubChem CID | 134261935 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | ethyl 2-(5-bromo-2-pyridinyl)-3-[2-(trifluoromethyl)cyclopropyl]propanoate |
| SMILES | CCOC(=O)C(CC1CC1C(F)(F)F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C14H15BrF3NO2/c1-2-21-13(20)10(12-4-3-9(15)7-19-12)5-8-6-11(8)14(16,17)18/h3-4,7-8,10-11H,2,5-6H2,1H3 |
| InChIKey | DXGJRKOQPNTONV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |