About ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate
ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate (PubChem CID 171223154) has the molecular formula C10H12Cl2N2O2
and a molecular weight of 263.12 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate.
Molecular Properties
| Compound Name | ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate |
| PubChem CID | 171223154 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-2-16-9(15)5-7(13)6-3-4-8(11)14-10(6)12/h3-4,7H,2,5,13H2,1H3/t7-/m0/s1 |
| InChIKey | COUHGVXTCJUYLZ-ZETCQYMHSA-N |
| XLogP | 2.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate?
The IUPAC name of ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate (CID 171223154) is ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate.
What is the SMILES notation for ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate?
The canonical SMILES for ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate is CCOC(=O)C[C@H](N)c1ccc(Cl)nc1Cl.
What is the InChIKey of ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate?
The InChIKey is COUHGVXTCJUYLZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H12Cl2N2O2/c1-2-16-9(15)5-7(13)6-3-4-8(11)14-10(6)12/h3-4,7H,2,5,13H2,1H3/t7-/m0/s1.
What are the key properties of ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate?
ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate has a molecular weight of 263.12 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-amino-3-(2,6-dichloro-3-pyridinyl)propanoate is sourced from PubChem (CID 171223154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).