C8H12Cl3N3 — CID 171223118
(1S)-1-(2,6-dichloro-3-pyridinyl)propane-1,3-diamine;hydrochloride (PubChem CID 171223118) has the molecular formula C8H12Cl3N3 and a molecular weight of 256.56 g/mol. Its IUPAC name is (1S)-1-(2,6-dichloro-3-pyridinyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1S)-1-(2,6-dichloro-3-pyridinyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171223118 |
| Molecular Formula | C8H12Cl3N3 |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | (1S)-1-(2,6-dichloro-3-pyridinyl)propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCC[C@H](N)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C8H11Cl2N3.ClH/c9-7-2-1-5(8(10)13-7)6(12)3-4-11;/h1-2,6H,3-4,11-12H2;1H/t6-;/m0./s1 |
| InChIKey | YCWCBFAYSLGRNG-RGMNGODLSA-N |
| XLogP | 2.16 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|