C8H11Cl3N2 — CID 171223124
(1S)-1-(2,6-dichloro-3-pyridinyl)propan-1-amine;hydrochloride (PubChem CID 171223124) has the molecular formula C8H11Cl3N2 and a molecular weight of 241.55 g/mol. Its IUPAC name is (1S)-1-(2,6-dichloro-3-pyridinyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,6-dichloro-3-pyridinyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171223124 |
| Molecular Formula | C8H11Cl3N2 |
| Molecular Weight | 241.55 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | (1S)-1-(2,6-dichloro-3-pyridinyl)propan-1-amine;hydrochloride |
| SMILES | CC[C@H](N)c1ccc(Cl)nc1Cl.Cl |
| InChI | InChI=1S/C8H10Cl2N2.ClH/c1-2-6(11)5-3-4-7(9)12-8(5)10;/h3-4,6H,2,11H2,1H3;1H/t6-;/m0./s1 |
| InChIKey | WUMGAQZVVFHDGM-RGMNGODLSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|