C10H10Cl2F2N2O2 — CID 171240861
ethyl (3R)-3-amino-3-(2,6-dichloro-3-pyridinyl)-2,2-difluoropropanoate (PubChem CID 171240861) has the molecular formula C10H10Cl2F2N2O2 and a molecular weight of 299.10 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2,6-dichloro-3-pyridinyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(2,6-dichloro-3-pyridinyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171240861 |
| Molecular Formula | C10H10Cl2F2N2O2 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2,6-dichloro-3-pyridinyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H10Cl2F2N2O2/c1-2-18-9(17)10(13,14)7(15)5-3-4-6(11)16-8(5)12/h3-4,7H,2,15H2,1H3/t7-/m1/s1 |
| InChIKey | ICILVPMUVABPML-SSDOTTSWSA-N |
| XLogP | 2.59 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|