C12H13Cl2NO4 — CID 153378550
diethyl 2-(2,6-dichloro-3-pyridinyl)propanedioate (PubChem CID 153378550) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is diethyl 2-(2,6-dichloro-3-pyridinyl)propanedioate.
| Compound Name | diethyl 2-(2,6-dichloro-3-pyridinyl)propanedioate |
|---|---|
| PubChem CID | 153378550 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | diethyl 2-(2,6-dichloro-3-pyridinyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H13Cl2NO4/c1-3-18-11(16)9(12(17)19-4-2)7-5-6-8(13)15-10(7)14/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | PEBDBWDKRYUPDI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|