C11H11Cl2NO3 — CID 70584243
ethyl 3-amino-2-(3,4-dichlorophenyl)-3-oxopropanoate (PubChem CID 70584243) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is ethyl 3-amino-2-(3,4-dichlorophenyl)-3-oxopropanoate.
| Compound Name | ethyl 3-amino-2-(3,4-dichlorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 70584243 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | ethyl 3-amino-2-(3,4-dichlorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO3/c1-2-17-11(16)9(10(14)15)6-3-4-7(12)8(13)5-6/h3-5,9H,2H2,1H3,(H2,14,15) |
| InChIKey | FFRIVIROMZPTDO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|