C13H10Cl2N2O2 — CID 131847806
ethyl 2,3-dicyano-3-(3,4-dichlorophenyl)propanoate (PubChem CID 131847806) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is ethyl 2,3-dicyano-3-(3,4-dichlorophenyl)propanoate.
| Compound Name | ethyl 2,3-dicyano-3-(3,4-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 131847806 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | ethyl 2,3-dicyano-3-(3,4-dichlorophenyl)propanoate |
| SMILES | CCOC(=O)C(C#N)C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O2/c1-2-19-13(18)10(7-17)9(6-16)8-3-4-11(14)12(15)5-8/h3-5,9-10H,2H2,1H3 |
| InChIKey | HFPCSCHEODJLTA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |