C19H23Cl2NO4 — CID 67635051
ethyl 2-[cyano-(3,4-dichlorophenyl)methyl]-3-(oxan-3-yloxy)butanoate (PubChem CID 67635051) has the molecular formula C19H23Cl2NO4 and a molecular weight of 400.30 g/mol. Its IUPAC name is ethyl 2-[cyano-(3,4-dichlorophenyl)methyl]-3-(oxan-3-yloxy)butanoate.
| Compound Name | ethyl 2-[cyano-(3,4-dichlorophenyl)methyl]-3-(oxan-3-yloxy)butanoate |
|---|---|
| PubChem CID | 67635051 |
| Molecular Formula | C19H23Cl2NO4 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl 2-[cyano-(3,4-dichlorophenyl)methyl]-3-(oxan-3-yloxy)butanoate |
| SMILES | CCOC(=O)C(C(C)OC1CCCOC1)C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO4/c1-3-25-19(23)18(12(2)26-14-5-4-8-24-11-14)15(10-22)13-6-7-16(20)17(21)9-13/h6-7,9,12,14-15,18H,3-5,8,11H2,1-2H3 |
| InChIKey | FXFUWXJDUHYING-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |