C19H17Cl2NO3 — CID 129386184
ethyl (2R,3S)-2-cyano-3-(3,4-dichlorophenyl)-3-(2-methoxyphenyl)propanoate (PubChem CID 129386184) has the molecular formula C19H17Cl2NO3 and a molecular weight of 378.26 g/mol. Its IUPAC name is ethyl (2R,3S)-2-cyano-3-(3,4-dichlorophenyl)-3-(2-methoxyphenyl)propanoate.
| Compound Name | ethyl (2R,3S)-2-cyano-3-(3,4-dichlorophenyl)-3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 129386184 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | ethyl (2R,3S)-2-cyano-3-(3,4-dichlorophenyl)-3-(2-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@@H](C#N)[C@@H](c1ccc(Cl)c(Cl)c1)c1ccccc1OC |
| InChI | InChI=1S/C19H17Cl2NO3/c1-3-25-19(23)14(11-22)18(12-8-9-15(20)16(21)10-12)13-6-4-5-7-17(13)24-2/h4-10,14,18H,3H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | NYIUPOLZCVMYHS-KSSFIOAISA-N |
| XLogP | 4.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |