About ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium
ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium (PubChem CID 172863601) has the molecular formula C18H19ClO5P+
and a molecular weight of 381.77 g/mol. Its IUPAC name is ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium.
Molecular Properties
| Compound Name | ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
| PubChem CID | 172863601 |
| Molecular Formula | C18H19ClO5P+ |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
| SMILES | CCOC(=O)C(C(=O)c1c(Cl)cccc1OC)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C18H17ClO4.H2OP/c1-3-23-18(21)15(12-8-5-4-6-9-12)17(20)16-13(19)10-7-11-14(16)22-2;1-2/h4-11,15H,3H2,1-2H3;2H2/q;+1 |
| InChIKey | LWIRZZDFIGISBV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium?
The IUPAC name of ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium (CID 172863601) is ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium.
What is the SMILES notation for ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium?
The canonical SMILES for ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium is CCOC(=O)C(C(=O)c1c(Cl)cccc1OC)c1ccccc1.O=[PH2+].
What is the InChIKey of ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium?
The InChIKey is LWIRZZDFIGISBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClO4.H2OP/c1-3-23-18(21)15(12-8-5-4-6-9-12)17(20)16-13(19)10-7-11-14(16)22-2;1-2/h4-11,15H,3H2,1-2H3;2H2/q;+1.
What are the key properties of ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium?
ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium has a molecular weight of 381.77 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium is sourced from PubChem (CID 172863601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).