C21H25ClO5P+ — CID 161092861
3-methylbutyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium (PubChem CID 161092861) has the molecular formula C21H25ClO5P+ and a molecular weight of 423.85 g/mol. Its IUPAC name is 3-methylbutyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium.
| Compound Name | 3-methylbutyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
|---|---|
| PubChem CID | 161092861 |
| Molecular Formula | C21H25ClO5P+ |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-methylbutyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
| SMILES | COc1cccc(Cl)c1C(=O)C(C(=O)OCCC(C)C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C21H23ClO4.H2OP/c1-14(2)12-13-26-21(24)18(15-8-5-4-6-9-15)20(23)19-16(22)10-7-11-17(19)25-3;1-2/h4-11,14,18H,12-13H2,1-3H3;2H2/q;+1 |
| InChIKey | BMINVSSVRIAZOT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|