About oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate
oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate (PubChem CID 161276355) has the molecular formula C19H21ClO5P+
and a molecular weight of 395.80 g/mol. Its IUPAC name is oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate.
Molecular Properties
| Compound Name | oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate |
| PubChem CID | 161276355 |
| Molecular Formula | C19H21ClO5P+ |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate |
| SMILES | COc1cccc(Cl)c1C(=O)C(C(=O)OC(C)C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C19H19ClO4.H2OP/c1-12(2)24-19(22)16(13-8-5-4-6-9-13)18(21)17-14(20)10-7-11-15(17)23-3;1-2/h4-12,16H,1-3H3;2H2/q;+1 |
| InChIKey | ZWAVWLQLRHCWEM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate?
The IUPAC name of oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate (CID 161276355) is oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate.
What is the SMILES notation for oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate?
The canonical SMILES for oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate is COc1cccc(Cl)c1C(=O)C(C(=O)OC(C)C)c1ccccc1.O=[PH2+].
What is the InChIKey of oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate?
The InChIKey is ZWAVWLQLRHCWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClO4.H2OP/c1-12(2)24-19(22)16(13-8-5-4-6-9-13)18(21)17-14(20)10-7-11-15(17)23-3;1-2/h4-12,16H,1-3H3;2H2/q;+1.
What are the key properties of oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate?
oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate has a molecular weight of 395.80 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxophosphanium;propan-2-yl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate is sourced from PubChem (CID 161276355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).