C22H16Cl2O3 — CID 18515070
benzyl 3-(2,6-dichlorophenyl)-3-oxo-2-phenylpropanoate (PubChem CID 18515070) has the molecular formula C22H16Cl2O3 and a molecular weight of 399.27 g/mol. Its IUPAC name is benzyl 3-(2,6-dichlorophenyl)-3-oxo-2-phenylpropanoate.
| Compound Name | benzyl 3-(2,6-dichlorophenyl)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 18515070 |
| Molecular Formula | C22H16Cl2O3 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | benzyl 3-(2,6-dichlorophenyl)-3-oxo-2-phenylpropanoate |
| SMILES | O=C(OCc1ccccc1)C(C(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl2O3/c23-17-12-7-13-18(24)20(17)21(25)19(16-10-5-2-6-11-16)22(26)27-14-15-8-3-1-4-9-15/h1-13,19H,14H2 |
| InChIKey | RMEMMJQBTMVLGH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|