C24H29ClO4 — CID 18514795
2,4,4-trimethylpentyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate (PubChem CID 18514795) has the molecular formula C24H29ClO4 and a molecular weight of 416.95 g/mol. Its IUPAC name is 2,4,4-trimethylpentyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate.
| Compound Name | 2,4,4-trimethylpentyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 18514795 |
| Molecular Formula | C24H29ClO4 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2,4,4-trimethylpentyl 3-(2-chloro-6-methoxyphenyl)-3-oxo-2-phenylpropanoate |
| SMILES | COc1cccc(Cl)c1C(=O)C(C(=O)OCC(C)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H29ClO4/c1-16(14-24(2,3)4)15-29-23(27)20(17-10-7-6-8-11-17)22(26)21-18(25)12-9-13-19(21)28-5/h6-13,16,20H,14-15H2,1-5H3 |
| InChIKey | ASRMEBDYDLCXSN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|