C19H22O6P+ — CID 159475443
ethyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium (PubChem CID 159475443) has the molecular formula C19H22O6P+ and a molecular weight of 377.35 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium.
| Compound Name | ethyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
|---|---|
| PubChem CID | 159475443 |
| Molecular Formula | C19H22O6P+ |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | ethyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
| SMILES | CCOC(=O)C(C(=O)c1c(OC)cccc1OC)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C19H20O5.H2OP/c1-4-24-19(21)16(13-9-6-5-7-10-13)18(20)17-14(22-2)11-8-12-15(17)23-3;1-2/h5-12,16H,4H2,1-3H3;2H2/q;+1 |
| InChIKey | VCHQSFWTUPEVCS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|