About ethyl 3-oxo-2-phenylpentanoate
ethyl 3-oxo-2-phenylpentanoate (PubChem CID 57306037) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl 3-oxo-2-phenylpentanoate.
Molecular Properties
| Compound Name | ethyl 3-oxo-2-phenylpentanoate |
| PubChem CID | 57306037 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl 3-oxo-2-phenylpentanoate |
| SMILES | CCOC(=O)C(C(=O)CC)c1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-3-11(14)12(13(15)16-4-2)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | BHZOYDWMQNKDNV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-2-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-2-phenylpentanoate?
The IUPAC name of ethyl 3-oxo-2-phenylpentanoate (CID 57306037) is ethyl 3-oxo-2-phenylpentanoate.
What is the SMILES notation for ethyl 3-oxo-2-phenylpentanoate?
The canonical SMILES for ethyl 3-oxo-2-phenylpentanoate is CCOC(=O)C(C(=O)CC)c1ccccc1.
What is the InChIKey of ethyl 3-oxo-2-phenylpentanoate?
The InChIKey is BHZOYDWMQNKDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-3-11(14)12(13(15)16-4-2)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3.
What are the key properties of ethyl 3-oxo-2-phenylpentanoate?
ethyl 3-oxo-2-phenylpentanoate has a molecular weight of 220.27 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-2-phenylpentanoate is sourced from PubChem (CID 57306037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).