About ethyl 2-amino-2-phenylacetate chloride
ethyl 2-amino-2-phenylacetate chloride (PubChem CID 3083657) has the molecular formula C10H13ClNO2-
and a molecular weight of 214.67 g/mol. Its IUPAC name is ethyl 2-amino-2-phenylacetate chloride.
Molecular Properties
| Compound Name | ethyl 2-amino-2-phenylacetate chloride |
| PubChem CID | 3083657 |
| Molecular Formula | C10H13ClNO2- |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | ethyl 2-amino-2-phenylacetate chloride |
| SMILES | CCOC(=O)C(N)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C10H13NO2.ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;/h3-7,9H,2,11H2,1H3;1H/p-1 |
| InChIKey | FNNXQLSKQSVNLL-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-amino-2-phenylacetate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-2-phenylacetate chloride?
The IUPAC name of ethyl 2-amino-2-phenylacetate chloride (CID 3083657) is ethyl 2-amino-2-phenylacetate chloride.
What is the SMILES notation for ethyl 2-amino-2-phenylacetate chloride?
The canonical SMILES for ethyl 2-amino-2-phenylacetate chloride is CCOC(=O)C(N)c1ccccc1.[Cl-].
What is the InChIKey of ethyl 2-amino-2-phenylacetate chloride?
The InChIKey is FNNXQLSKQSVNLL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13NO2.ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;/h3-7,9H,2,11H2,1H3;1H/p-1.
What are the key properties of ethyl 2-amino-2-phenylacetate chloride?
ethyl 2-amino-2-phenylacetate chloride has a molecular weight of 214.67 g/mol, XLogP of -1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-2-phenylacetate chloride is sourced from PubChem (CID 3083657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).