C21H27ClN2O5 — CID 158687783
ethyl 2-amino-2-phenylacetate;ethyl 2-formamido-2-phenylacetate;hydrochloride (PubChem CID 158687783) has the molecular formula C21H27ClN2O5 and a molecular weight of 422.91 g/mol. Its IUPAC name is ethyl 2-amino-2-phenylacetate;ethyl 2-formamido-2-phenylacetate;hydrochloride.
| Compound Name | ethyl 2-amino-2-phenylacetate;ethyl 2-formamido-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 158687783 |
| Molecular Formula | C21H27ClN2O5 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl 2-amino-2-phenylacetate;ethyl 2-formamido-2-phenylacetate;hydrochloride |
| SMILES | CCOC(=O)C(N)c1ccccc1.CCOC(=O)C(NC=O)c1ccccc1.Cl |
| InChI | InChI=1S/C11H13NO3.C10H13NO2.ClH/c1-2-15-11(14)10(12-8-13)9-6-4-3-5-7-9;1-2-13-10(12)9(11)8-6-4-3-5-7-8;/h3-8,10H,2H2,1H3,(H,12,13);3-7,9H,2,11H2,1H3;1H |
| InChIKey | LTFWLKLOQKBGOU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|