C18H29NO2 — CID 103601305
ethyl 2-phenyl-2-(2,4,4-trimethylpentan-2-ylamino)acetate (PubChem CID 103601305) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is ethyl 2-phenyl-2-(2,4,4-trimethylpentan-2-ylamino)acetate.
| Compound Name | ethyl 2-phenyl-2-(2,4,4-trimethylpentan-2-ylamino)acetate |
|---|---|
| PubChem CID | 103601305 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | ethyl 2-phenyl-2-(2,4,4-trimethylpentan-2-ylamino)acetate |
| SMILES | CCOC(=O)C(NC(C)(C)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2/c1-7-21-16(20)15(14-11-9-8-10-12-14)19-18(5,6)13-17(2,3)4/h8-12,15,19H,7,13H2,1-6H3 |
| InChIKey | FTFCHYMRDSRMGM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |