C17H27NO3 — CID 103952051
ethyl 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-phenylacetate (PubChem CID 103952051) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-phenylacetate.
| Compound Name | ethyl 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 103952051 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | ethyl 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-phenylacetate |
| SMILES | CCOC(=O)C(NCC(O)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27NO3/c1-5-21-16(20)15(13-9-7-6-8-10-13)18-12-14(19)11-17(2,3)4/h6-10,14-15,18-19H,5,11-12H2,1-4H3 |
| InChIKey | PYXGJUNORFETCP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |