C22H32O5 — CID 22184019
3-methylbutyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropanoate (PubChem CID 22184019) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-methylbutyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropanoate.
| Compound Name | 3-methylbutyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 22184019 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3-methylbutyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropanoate |
| SMILES | COc1cccc(OC)c1C(=O)C(C(=O)OCCC(C)C)C1CCCCC1 |
| InChI | InChI=1S/C22H32O5/c1-15(2)13-14-27-22(24)19(16-9-6-5-7-10-16)21(23)20-17(25-3)11-8-12-18(20)26-4/h8,11-12,15-16,19H,5-7,9-10,13-14H2,1-4H3 |
| InChIKey | AKPFZOZANWEZDK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|