C18H26O6P+ — CID 22183862
[1-cyclohexyl-2-(2,6-dimethoxyphenyl)-2-oxoethoxy]-ethoxy-oxophosphanium (PubChem CID 22183862) has the molecular formula C18H26O6P+ and a molecular weight of 369.37 g/mol. Its IUPAC name is [1-cyclohexyl-2-(2,6-dimethoxyphenyl)-2-oxoethoxy]-ethoxy-oxophosphanium.
| Compound Name | [1-cyclohexyl-2-(2,6-dimethoxyphenyl)-2-oxoethoxy]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 22183862 |
| Molecular Formula | C18H26O6P+ |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [1-cyclohexyl-2-(2,6-dimethoxyphenyl)-2-oxoethoxy]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)OC(C(=O)c1c(OC)cccc1OC)C1CCCCC1 |
| InChI | InChI=1S/C18H26O6P/c1-4-23-25(20)24-18(13-9-6-5-7-10-13)17(19)16-14(21-2)11-8-12-15(16)22-3/h8,11-13,18H,4-7,9-10H2,1-3H3/q+1 |
| InChIKey | QUJPVXBVJZLXFD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|