C20H30O8P+ — CID 173194784
1-methoxyethyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropaneperoxoate;oxophosphanium (PubChem CID 173194784) has the molecular formula C20H30O8P+ and a molecular weight of 429.43 g/mol. Its IUPAC name is 1-methoxyethyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropaneperoxoate;oxophosphanium.
| Compound Name | 1-methoxyethyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropaneperoxoate;oxophosphanium |
|---|---|
| PubChem CID | 173194784 |
| Molecular Formula | C20H30O8P+ |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-methoxyethyl 2-cyclohexyl-3-(2,6-dimethoxyphenyl)-3-oxopropaneperoxoate;oxophosphanium |
| SMILES | COc1cccc(OC)c1C(=O)C(C(=O)OOC(C)OC)C1CCCCC1.O=[PH2+] |
| InChI | InChI=1S/C20H28O7.H2OP/c1-13(23-2)26-27-20(22)17(14-9-6-5-7-10-14)19(21)18-15(24-3)11-8-12-16(18)25-4;1-2/h8,11-14,17H,5-7,9-10H2,1-4H3;2H2/q;+1 |
| InChIKey | KONNKYHQMRRVSP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|