C24H38O4P+ — CID 161319035
hexyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium (PubChem CID 161319035) has the molecular formula C24H38O4P+ and a molecular weight of 421.54 g/mol. Its IUPAC name is hexyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium.
| Compound Name | hexyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium |
|---|---|
| PubChem CID | 161319035 |
| Molecular Formula | C24H38O4P+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | hexyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium |
| SMILES | CCCCCCOC(=O)C(C(=O)c1c(C)cc(C)cc1C)C1CCCCC1.O=[PH2+] |
| InChI | InChI=1S/C24H36O3.H2OP/c1-5-6-7-11-14-27-24(26)22(20-12-9-8-10-13-20)23(25)21-18(3)15-17(2)16-19(21)4;1-2/h15-16,20,22H,5-14H2,1-4H3;2H2/q;+1 |
| InChIKey | OESUKZFRNFMNRP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|